About 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol
1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol (PubChem CID 130550371) has the molecular formula C8H12N2OS3
and a molecular weight of 248.40 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol |
| PubChem CID | 130550371 |
| Molecular Formula | C8H12N2OS3 |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol |
| SMILES | OC(Cc1csnn1)C1CSCCS1 |
| InChI | InChI=1S/C8H12N2OS3/c11-7(3-6-4-14-10-9-6)8-5-12-1-2-13-8/h4,7-8,11H,1-3,5H2 |
| InChIKey | XHAZHEHSFWKYMQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol?
The IUPAC name of 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol (CID 130550371) is 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol.
What is the SMILES notation for 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol?
The canonical SMILES for 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol is OC(Cc1csnn1)C1CSCCS1.
What is the InChIKey of 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol?
The InChIKey is XHAZHEHSFWKYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS3/c11-7(3-6-4-14-10-9-6)8-5-12-1-2-13-8/h4,7-8,11H,1-3,5H2.
What are the key properties of 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol?
1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol has a molecular weight of 248.40 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dithian-2-yl)-2-(thiadiazol-4-yl)ethanol is sourced from PubChem (CID 130550371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).