About [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine
[6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine (PubChem CID 130551424) has the molecular formula C7H8N6S
and a molecular weight of 208.25 g/mol. Its IUPAC name is [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine |
| PubChem CID | 130551424 |
| Molecular Formula | C7H8N6S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine |
| SMILES | NCc1cc(Sc2ncn[nH]2)ncn1 |
| InChI | InChI=1S/C7H8N6S/c8-2-5-1-6(10-3-9-5)14-7-11-4-12-13-7/h1,3-4H,2,8H2,(H,11,12,13) |
| InChIKey | SWLDQKKOEXYHOP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine?
The IUPAC name of [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine (CID 130551424) is [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine.
What is the SMILES notation for [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine?
The canonical SMILES for [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine is NCc1cc(Sc2ncn[nH]2)ncn1.
What is the InChIKey of [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine?
The InChIKey is SWLDQKKOEXYHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6S/c8-2-5-1-6(10-3-9-5)14-7-11-4-12-13-7/h1,3-4H,2,8H2,(H,11,12,13).
What are the key properties of [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine?
[6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine has a molecular weight of 208.25 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidin-4-yl]methanamine is sourced from PubChem (CID 130551424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).