C9H16Cl2N2O — CID 130551928
N-(2,2-dichloroethyl)-4-methylpiperidine-2-carboxamide (PubChem CID 130551928) has the molecular formula C9H16Cl2N2O and a molecular weight of 239.15 g/mol. Its IUPAC name is N-(2,2-dichloroethyl)-4-methylpiperidine-2-carboxamide.
| Compound Name | N-(2,2-dichloroethyl)-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 130551928 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-(2,2-dichloroethyl)-4-methylpiperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)NCC(Cl)Cl)C1 |
| InChI | InChI=1S/C9H16Cl2N2O/c1-6-2-3-12-7(4-6)9(14)13-5-8(10)11/h6-8,12H,2-5H2,1H3,(H,13,14) |
| InChIKey | DQAQPNLQFCXDRJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|