C8H13BrF2N2O — CID 130551930
3-amino-N-(2-bromo-2,2-difluoroethyl)cyclopentane-1-carboxamide (PubChem CID 130551930) has the molecular formula C8H13BrF2N2O and a molecular weight of 271.11 g/mol. Its IUPAC name is 3-amino-N-(2-bromo-2,2-difluoroethyl)cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-(2-bromo-2,2-difluoroethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 130551930 |
| Molecular Formula | C8H13BrF2N2O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-amino-N-(2-bromo-2,2-difluoroethyl)cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCC(F)(F)Br)C1 |
| InChI | InChI=1S/C8H13BrF2N2O/c9-8(10,11)4-13-7(14)5-1-2-6(12)3-5/h5-6H,1-4,12H2,(H,13,14) |
| InChIKey | PSEXFBXLPRNBSR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|