C12H18N2 — CID 130552141
2-methyl-N-[(2-methyl-3-pyridinyl)methyl]cyclobutan-1-amine (PubChem CID 130552141) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methyl-N-[(2-methyl-3-pyridinyl)methyl]cyclobutan-1-amine.
| Compound Name | 2-methyl-N-[(2-methyl-3-pyridinyl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 130552141 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-methyl-N-[(2-methyl-3-pyridinyl)methyl]cyclobutan-1-amine |
| SMILES | Cc1ncccc1CNC1CCC1C |
| InChI | InChI=1S/C12H18N2/c1-9-5-6-12(9)14-8-11-4-3-7-13-10(11)2/h3-4,7,9,12,14H,5-6,8H2,1-2H3 |
| InChIKey | QXKHEWYEJODBNI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |