C8H9IN4S — CID 130552838
4-[(4-iodopyrazol-1-yl)methyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 130552838) has the molecular formula C8H9IN4S and a molecular weight of 320.16 g/mol. Its IUPAC name is 4-[(4-iodopyrazol-1-yl)methyl]-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-[(4-iodopyrazol-1-yl)methyl]-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130552838 |
| Molecular Formula | C8H9IN4S |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 4-[(4-iodopyrazol-1-yl)methyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(Cn2cc(I)cn2)cs1 |
| InChI | InChI=1S/C8H9IN4S/c1-10-8-12-7(5-14-8)4-13-3-6(9)2-11-13/h2-3,5H,4H2,1H3,(H,10,12) |
| InChIKey | JISDZXWFURSJNQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|