C6H8Cl2N4 — CID 13055463
3,6-dichloro-N-propan-2-yl-1,2,4-triazin-5-amine (PubChem CID 13055463) has the molecular formula C6H8Cl2N4 and a molecular weight of 207.06 g/mol. Its IUPAC name is 3,6-dichloro-N-propan-2-yl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-propan-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 13055463 |
| Molecular Formula | C6H8Cl2N4 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 3,6-dichloro-N-propan-2-yl-1,2,4-triazin-5-amine |
| SMILES | CC(C)Nc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C6H8Cl2N4/c1-3(2)9-5-4(7)11-12-6(8)10-5/h3H,1-2H3,(H,9,10,12) |
| InChIKey | XRVIEJCRABCBPW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |