C11H13NO3 — CID 130556374
1-(2-methylcyclobutyl)-6-oxopyridine-3-carboxylic acid (PubChem CID 130556374) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(2-methylcyclobutyl)-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(2-methylcyclobutyl)-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130556374 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-(2-methylcyclobutyl)-6-oxopyridine-3-carboxylic acid |
| SMILES | CC1CCC1n1cc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C11H13NO3/c1-7-2-4-9(7)12-6-8(11(14)15)3-5-10(12)13/h3,5-7,9H,2,4H2,1H3,(H,14,15) |
| InChIKey | GDTOFXDQMZIHBH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |