About 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine
2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine (PubChem CID 130557090) has the molecular formula C18H27N3
and a molecular weight of 285.43 g/mol. Its IUPAC name is 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine.
Molecular Properties
| Compound Name | 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine |
| PubChem CID | 130557090 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine |
| SMILES | CC12CCC(C1)C(C)(C)C2N/C(N)=N/Cc1ccccc1 |
| InChI | InChI=1S/C18H27N3/c1-17(2)14-9-10-18(3,11-14)15(17)21-16(19)20-12-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H3,19,20,21) |
| InChIKey | OLBORZCWKNQDKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine?
The IUPAC name of 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine (CID 130557090) is 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine.
What is the SMILES notation for 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine?
The canonical SMILES for 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine is CC12CCC(C1)C(C)(C)C2N/C(N)=N/Cc1ccccc1.
What is the InChIKey of 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine?
The InChIKey is OLBORZCWKNQDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3/c1-17(2)14-9-10-18(3,11-14)15(17)21-16(19)20-12-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H3,19,20,21).
What are the key properties of 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine?
2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine has a molecular weight of 285.43 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)guanidine is sourced from PubChem (CID 130557090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).