C5H9N3S — CID 130557608
N,N,3-trimethyl-1,2,4-thiadiazol-5-amine (PubChem CID 130557608) has the molecular formula C5H9N3S and a molecular weight of 143.21 g/mol. Its IUPAC name is N,N,3-trimethyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N,N,3-trimethyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130557608 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | N,N,3-trimethyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(N(C)C)n1 |
| InChI | InChI=1S/C5H9N3S/c1-4-6-5(8(2)3)9-7-4/h1-3H3 |
| InChIKey | JFBLAVXSZFAYEJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |