About tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate
tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 130557651) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| PubChem CID | 130557651 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CN(C)C1=NCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H21N3O2/c1-11(2,3)16-10(15)14-7-6-12-9(8-14)13(4)5/h6-8H2,1-5H3 |
| InChIKey | GVLNLCDMYMFURC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The IUPAC name of tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (CID 130557651) is tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
What is the SMILES notation for tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The canonical SMILES for tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate is CN(C)C1=NCCN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The InChIKey is GVLNLCDMYMFURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-11(2,3)16-10(15)14-7-6-12-9(8-14)13(4)5/h6-8H2,1-5H3.
What are the key properties of tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(dimethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate is sourced from PubChem (CID 130557651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).