C8H14N4O2 — CID 130557665
1-ethyl-N,N,3-trimethyl-4-nitropyrazol-5-amine (PubChem CID 130557665) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-ethyl-N,N,3-trimethyl-4-nitropyrazol-5-amine.
| Compound Name | 1-ethyl-N,N,3-trimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 130557665 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-ethyl-N,N,3-trimethyl-4-nitropyrazol-5-amine |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1N(C)C |
| InChI | InChI=1S/C8H14N4O2/c1-5-11-8(10(3)4)7(12(13)14)6(2)9-11/h5H2,1-4H3 |
| InChIKey | RNGWOTFIQAIROI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|