About (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone
(5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone (PubChem CID 13055781) has the molecular formula C17H12N2O2S
and a molecular weight of 308.36 g/mol. Its IUPAC name is (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone |
| PubChem CID | 13055781 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone |
| SMILES | COc1cc2nc(C(=O)c3cccs3)cn2c2ccccc12 |
| InChI | InChI=1S/C17H12N2O2S/c1-21-14-9-16-18-12(17(20)15-7-4-8-22-15)10-19(16)13-6-3-2-5-11(13)14/h2-10H,1H3 |
| InChIKey | HOPLWYZHBVOVFE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone?
The IUPAC name of (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone (CID 13055781) is (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone.
What is the SMILES notation for (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone?
The canonical SMILES for (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone is COc1cc2nc(C(=O)c3cccs3)cn2c2ccccc12.
What is the InChIKey of (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone?
The InChIKey is HOPLWYZHBVOVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2S/c1-21-14-9-16-18-12(17(20)15-7-4-8-22-15)10-19(16)13-6-3-2-5-11(13)14/h2-10H,1H3.
What are the key properties of (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone?
(5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone has a molecular weight of 308.36 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxyimidazo[1,2-a]quinolin-2-yl)-thiophen-2-ylmethanone is sourced from PubChem (CID 13055781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).