About 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole
2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole (PubChem CID 130558797) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole |
| PubChem CID | 130558797 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole |
| SMILES | Cc1cc(CC2C=CCN2)cs1 |
| InChI | InChI=1S/C10H13NS/c1-8-5-9(7-12-8)6-10-3-2-4-11-10/h2-3,5,7,10-11H,4,6H2,1H3 |
| InChIKey | ZUHOGMZFJWQZNM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole?
The IUPAC name of 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole (CID 130558797) is 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole is Cc1cc(CC2C=CCN2)cs1.
What is the InChIKey of 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole?
The InChIKey is ZUHOGMZFJWQZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-8-5-9(7-12-8)6-10-3-2-4-11-10/h2-3,5,7,10-11H,4,6H2,1H3.
What are the key properties of 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole?
2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole has a molecular weight of 179.29 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methylthiophen-3-yl)methyl]-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 130558797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).