C10H17ClN4 — CID 130559431
4-chloro-3-methyl-1-[2-(1,2,4-triazol-1-yl)ethyl]piperidine (PubChem CID 130559431) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 4-chloro-3-methyl-1-[2-(1,2,4-triazol-1-yl)ethyl]piperidine.
| Compound Name | 4-chloro-3-methyl-1-[2-(1,2,4-triazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 130559431 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-chloro-3-methyl-1-[2-(1,2,4-triazol-1-yl)ethyl]piperidine |
| SMILES | CC1CN(CCn2cncn2)CCC1Cl |
| InChI | InChI=1S/C10H17ClN4/c1-9-6-14(3-2-10(9)11)4-5-15-8-12-7-13-15/h7-10H,2-6H2,1H3 |
| InChIKey | CTCMESVQIFGRMV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|