C16H16F3N3O — CID 13055950
(E)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)-1-[4-(trifluoromethyl)phenyl]pent-1-en-3-one (PubChem CID 13055950) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is (E)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)-1-[4-(trifluoromethyl)phenyl]pent-1-en-3-one.
| Compound Name | (E)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)-1-[4-(trifluoromethyl)phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 13055950 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)-1-[4-(trifluoromethyl)phenyl]pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C(=C\c1ccc(C(F)(F)F)cc1)n1cncn1 |
| InChI | InChI=1S/C16H16F3N3O/c1-15(2,3)14(23)13(22-10-20-9-21-22)8-11-4-6-12(7-5-11)16(17,18)19/h4-10H,1-3H3/b13-8+ |
| InChIKey | OZOKKCYEUHUYQN-MDWZMJQESA-N |
| XLogP | 3.91 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|