About 5-cyclobutyl-2,3-dimethylpiperidine
5-cyclobutyl-2,3-dimethylpiperidine (PubChem CID 130560543) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 5-cyclobutyl-2,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 5-cyclobutyl-2,3-dimethylpiperidine |
| PubChem CID | 130560543 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 5-cyclobutyl-2,3-dimethylpiperidine |
| SMILES | CC1CC(C2CCC2)CNC1C |
| InChI | InChI=1S/C11H21N/c1-8-6-11(7-12-9(8)2)10-4-3-5-10/h8-12H,3-7H2,1-2H3 |
| InChIKey | HTMVTYQHCPPVGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclobutyl-2,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyl-2,3-dimethylpiperidine?
The IUPAC name of 5-cyclobutyl-2,3-dimethylpiperidine (CID 130560543) is 5-cyclobutyl-2,3-dimethylpiperidine.
What is the SMILES notation for 5-cyclobutyl-2,3-dimethylpiperidine?
The canonical SMILES for 5-cyclobutyl-2,3-dimethylpiperidine is CC1CC(C2CCC2)CNC1C.
What is the InChIKey of 5-cyclobutyl-2,3-dimethylpiperidine?
The InChIKey is HTMVTYQHCPPVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-8-6-11(7-12-9(8)2)10-4-3-5-10/h8-12H,3-7H2,1-2H3.
What are the key properties of 5-cyclobutyl-2,3-dimethylpiperidine?
5-cyclobutyl-2,3-dimethylpiperidine has a molecular weight of 167.30 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyl-2,3-dimethylpiperidine is sourced from PubChem (CID 130560543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).