About [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine
[2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine (PubChem CID 130560614) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine |
| PubChem CID | 130560614 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine |
| SMILES | Cc1cc(C2CCC2CN)cnc1C |
| InChI | InChI=1S/C12H18N2/c1-8-5-11(7-14-9(8)2)12-4-3-10(12)6-13/h5,7,10,12H,3-4,6,13H2,1-2H3 |
| InChIKey | ZAGNLLAKXRVBOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine?
The IUPAC name of [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine (CID 130560614) is [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine.
What is the SMILES notation for [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine?
The canonical SMILES for [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine is Cc1cc(C2CCC2CN)cnc1C.
What is the InChIKey of [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine?
The InChIKey is ZAGNLLAKXRVBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-8-5-11(7-14-9(8)2)12-4-3-10(12)6-13/h5,7,10,12H,3-4,6,13H2,1-2H3.
What are the key properties of [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine?
[2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine has a molecular weight of 190.29 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,6-dimethyl-3-pyridinyl)cyclobutyl]methanamine is sourced from PubChem (CID 130560614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).