C7H10ClF2N5 — CID 130561101
6-(1-chloroethyl)-2-N-(2,2-difluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 130561101) has the molecular formula C7H10ClF2N5 and a molecular weight of 237.64 g/mol. Its IUPAC name is 6-(1-chloroethyl)-2-N-(2,2-difluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-chloroethyl)-2-N-(2,2-difluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130561101 |
| Molecular Formula | C7H10ClF2N5 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 6-(1-chloroethyl)-2-N-(2,2-difluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Cl)c1nc(N)nc(NCC(F)F)n1 |
| InChI | InChI=1S/C7H10ClF2N5/c1-3(8)5-13-6(11)15-7(14-5)12-2-4(9)10/h3-4H,2H2,1H3,(H3,11,12,13,14,15) |
| InChIKey | FQRJKXWOEVUGIW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|