About 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile
3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile (PubChem CID 130562534) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile |
| PubChem CID | 130562534 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN1CC(C)C(C)(CN)C1 |
| InChI | InChI=1S/C11H21N3/c1-9(4-12)5-14-6-10(2)11(3,7-13)8-14/h9-10H,5-8,13H2,1-3H3 |
| InChIKey | DUPHROJRTBVJDO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile?
The IUPAC name of 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile (CID 130562534) is 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile.
What is the SMILES notation for 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile?
The canonical SMILES for 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile is CC(C#N)CN1CC(C)C(C)(CN)C1.
What is the InChIKey of 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile?
The InChIKey is DUPHROJRTBVJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-9(4-12)5-14-6-10(2)11(3,7-13)8-14/h9-10H,5-8,13H2,1-3H3.
What are the key properties of 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile?
3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile has a molecular weight of 195.31 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-2-methylpropanenitrile is sourced from PubChem (CID 130562534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).