C10H10O — CID 13056304
5-oxahexacyclo[5.4.0.02,11.03,9.04,6.08,10]undecane (PubChem CID 13056304) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-oxahexacyclo[5.4.0.02,11.03,9.04,6.08,10]undecane.
| Compound Name | 5-oxahexacyclo[5.4.0.02,11.03,9.04,6.08,10]undecane |
|---|---|
| PubChem CID | 13056304 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 5-oxahexacyclo[5.4.0.02,11.03,9.04,6.08,10]undecane |
| SMILES | O1C2C1C1C3C4C2C2C1C2C43 |
| InChI | InChI=1S/C10H10O/c11-9-7-3-1-2-5(7)6(2)8(4(1)3)10(9)11/h1-10H |
| InChIKey | WQFROJNXZCJULC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|