About 1,3,5-tricyclopropylbenzene
1,3,5-tricyclopropylbenzene (PubChem CID 13056331) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,3,5-tricyclopropylbenzene.
Molecular Properties
| Compound Name | 1,3,5-tricyclopropylbenzene |
| PubChem CID | 13056331 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,3,5-tricyclopropylbenzene |
| SMILES | c1c(C2CC2)cc(C2CC2)cc1C1CC1 |
| InChI | InChI=1S/C15H18/c1-2-10(1)13-7-14(11-3-4-11)9-15(8-13)12-5-6-12/h7-12H,1-6H2 |
| InChIKey | WCQIACWDQWOQCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5-tricyclopropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-tricyclopropylbenzene?
The IUPAC name of 1,3,5-tricyclopropylbenzene (CID 13056331) is 1,3,5-tricyclopropylbenzene.
What is the SMILES notation for 1,3,5-tricyclopropylbenzene?
The canonical SMILES for 1,3,5-tricyclopropylbenzene is c1c(C2CC2)cc(C2CC2)cc1C1CC1.
What is the InChIKey of 1,3,5-tricyclopropylbenzene?
The InChIKey is WCQIACWDQWOQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-2-10(1)13-7-14(11-3-4-11)9-15(8-13)12-5-6-12/h7-12H,1-6H2.
What are the key properties of 1,3,5-tricyclopropylbenzene?
1,3,5-tricyclopropylbenzene has a molecular weight of 198.31 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-tricyclopropylbenzene is sourced from PubChem (CID 13056331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).