About 2,2-dimethoxyethylurea
2,2-dimethoxyethylurea (PubChem CID 13056426) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,2-dimethoxyethylurea.
Molecular Properties
| Compound Name | 2,2-dimethoxyethylurea |
| PubChem CID | 13056426 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 2,2-dimethoxyethylurea |
| SMILES | COC(CNC(N)=O)OC |
| InChI | InChI=1S/C5H12N2O3/c1-9-4(10-2)3-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8) |
| InChIKey | NBWCUGCUILLCCN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethylurea?
The IUPAC name of 2,2-dimethoxyethylurea (CID 13056426) is 2,2-dimethoxyethylurea.
What is the SMILES notation for 2,2-dimethoxyethylurea?
The canonical SMILES for 2,2-dimethoxyethylurea is COC(CNC(N)=O)OC.
What is the InChIKey of 2,2-dimethoxyethylurea?
The InChIKey is NBWCUGCUILLCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O3/c1-9-4(10-2)3-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8).
What are the key properties of 2,2-dimethoxyethylurea?
2,2-dimethoxyethylurea has a molecular weight of 148.16 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethylurea is sourced from PubChem (CID 13056426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).