C8H14N4O2 — CID 130567345
2-[4-[(1S)-1-hydroxyethyl]triazol-1-yl]-N-methylpropanamide (PubChem CID 130567345) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[4-[(1S)-1-hydroxyethyl]triazol-1-yl]-N-methylpropanamide.
| Compound Name | 2-[4-[(1S)-1-hydroxyethyl]triazol-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 130567345 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-[4-[(1S)-1-hydroxyethyl]triazol-1-yl]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)n1cc([C@H](C)O)nn1 |
| InChI | InChI=1S/C8H14N4O2/c1-5(8(14)9-3)12-4-7(6(2)13)10-11-12/h4-6,13H,1-3H3,(H,9,14)/t5?,6-/m0/s1 |
| InChIKey | KWYVTNSMMPWLQX-GDVGLLTNSA-N |
| XLogP | -0.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |