C6H8F3N3O — CID 130567367
(1S)-1-[1-(2,2,2-trifluoroethyl)triazol-4-yl]ethanol (PubChem CID 130567367) has the molecular formula C6H8F3N3O and a molecular weight of 195.14 g/mol. Its IUPAC name is (1S)-1-[1-(2,2,2-trifluoroethyl)triazol-4-yl]ethanol.
| Compound Name | (1S)-1-[1-(2,2,2-trifluoroethyl)triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 130567367 |
| Molecular Formula | C6H8F3N3O |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (1S)-1-[1-(2,2,2-trifluoroethyl)triazol-4-yl]ethanol |
| SMILES | C[C@H](O)c1cn(CC(F)(F)F)nn1 |
| InChI | InChI=1S/C6H8F3N3O/c1-4(13)5-2-12(11-10-5)3-6(7,8)9/h2,4,13H,3H2,1H3/t4-/m0/s1 |
| InChIKey | QNLUUNIXDIABFX-BYPYZUCNSA-N |
| XLogP | 0.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |