About 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide
2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide (PubChem CID 130568827) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 130568827 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide |
| SMILES | CC(C)c1ncn(CC(N)=O)n1 |
| InChI | InChI=1S/C7H12N4O/c1-5(2)7-9-4-11(10-7)3-6(8)12/h4-5H,3H2,1-2H3,(H2,8,12) |
| InChIKey | NNWLGVZQMSLLKL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide (CID 130568827) is 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide is CC(C)c1ncn(CC(N)=O)n1.
What is the InChIKey of 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide?
The InChIKey is NNWLGVZQMSLLKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-5(2)7-9-4-11(10-7)3-6(8)12/h4-5H,3H2,1-2H3,(H2,8,12).
What are the key properties of 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide?
2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide has a molecular weight of 168.20 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propan-2-yl-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 130568827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).