C9H16N4O — CID 130570243
2-(oxolan-3-yl)-5-propyl-1,2,4-triazol-3-amine (PubChem CID 130570243) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-5-propyl-1,2,4-triazol-3-amine.
| Compound Name | 2-(oxolan-3-yl)-5-propyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130570243 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-(oxolan-3-yl)-5-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCc1nc(N)n(C2CCOC2)n1 |
| InChI | InChI=1S/C9H16N4O/c1-2-3-8-11-9(10)13(12-8)7-4-5-14-6-7/h7H,2-6H2,1H3,(H2,10,11,12) |
| InChIKey | FUBXMRWERSOIOA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |