C9H10ClF2N3 — CID 130571055
N-[1-(chloromethyl)cyclopropyl]-3-(difluoromethyl)pyrazin-2-amine (PubChem CID 130571055) has the molecular formula C9H10ClF2N3 and a molecular weight of 233.65 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclopropyl]-3-(difluoromethyl)pyrazin-2-amine.
| Compound Name | N-[1-(chloromethyl)cyclopropyl]-3-(difluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 130571055 |
| Molecular Formula | C9H10ClF2N3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | N-[1-(chloromethyl)cyclopropyl]-3-(difluoromethyl)pyrazin-2-amine |
| SMILES | FC(F)c1nccnc1NC1(CCl)CC1 |
| InChI | InChI=1S/C9H10ClF2N3/c10-5-9(1-2-9)15-8-6(7(11)12)13-3-4-14-8/h3-4,7H,1-2,5H2,(H,14,15) |
| InChIKey | BNVOHKMDJAPLEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|