About 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol
4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol (PubChem CID 130571239) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol.
Molecular Properties
| Compound Name | 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol |
| PubChem CID | 130571239 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol |
| SMILES | COc1nc(C2(O)CCOCC2)cs1 |
| InChI | InChI=1S/C9H13NO3S/c1-12-8-10-7(6-14-8)9(11)2-4-13-5-3-9/h6,11H,2-5H2,1H3 |
| InChIKey | XXSVNQYLCLQQDS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol?
The IUPAC name of 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol (CID 130571239) is 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol.
What is the SMILES notation for 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol?
The canonical SMILES for 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol is COc1nc(C2(O)CCOCC2)cs1.
What is the InChIKey of 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol?
The InChIKey is XXSVNQYLCLQQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-12-8-10-7(6-14-8)9(11)2-4-13-5-3-9/h6,11H,2-5H2,1H3.
What are the key properties of 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol?
4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol has a molecular weight of 215.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxy-1,3-thiazol-4-yl)oxan-4-ol is sourced from PubChem (CID 130571239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).