C9H11NO3S — CID 130571308
(2-methoxy-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone (PubChem CID 130571308) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is (2-methoxy-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone.
| Compound Name | (2-methoxy-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 130571308 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | (2-methoxy-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone |
| SMILES | COc1nc(C(=O)C2CCOC2)cs1 |
| InChI | InChI=1S/C9H11NO3S/c1-12-9-10-7(5-14-9)8(11)6-2-3-13-4-6/h5-6H,2-4H2,1H3 |
| InChIKey | GXFBIEGLAPDBSR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |