C7H14N2O4S — CID 130571757
3-(methylamino)-N-methylsulfonyloxolane-3-carboxamide (PubChem CID 130571757) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(methylamino)-N-methylsulfonyloxolane-3-carboxamide.
| Compound Name | 3-(methylamino)-N-methylsulfonyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 130571757 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(methylamino)-N-methylsulfonyloxolane-3-carboxamide |
| SMILES | CNC1(C(=O)NS(C)(=O)=O)CCOC1 |
| InChI | InChI=1S/C7H14N2O4S/c1-8-7(3-4-13-5-7)6(10)9-14(2,11)12/h8H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | YQSNTUYAKAIFMO-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |