About 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine
4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine (PubChem CID 130572518) has the molecular formula C11H13BrN2S
and a molecular weight of 285.21 g/mol. Its IUPAC name is 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine |
| PubChem CID | 130572518 |
| Molecular Formula | C11H13BrN2S |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine |
| SMILES | CCN(CC)c1ncc(Br)c2ccsc12 |
| InChI | InChI=1S/C11H13BrN2S/c1-3-14(4-2)11-10-8(5-6-15-10)9(12)7-13-11/h5-7H,3-4H2,1-2H3 |
| InChIKey | RXXJJQAXTBPPGS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine?
The IUPAC name of 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine (CID 130572518) is 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine.
What is the SMILES notation for 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine?
The canonical SMILES for 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine is CCN(CC)c1ncc(Br)c2ccsc12.
What is the InChIKey of 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine?
The InChIKey is RXXJJQAXTBPPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2S/c1-3-14(4-2)11-10-8(5-6-15-10)9(12)7-13-11/h5-7H,3-4H2,1-2H3.
What are the key properties of 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine?
4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine has a molecular weight of 285.21 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-diethylthieno[2,3-c]pyridin-7-amine is sourced from PubChem (CID 130572518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).