About (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone
(2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone (PubChem CID 130572977) has the molecular formula C7H7N5O
and a molecular weight of 177.17 g/mol. Its IUPAC name is (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone.
Molecular Properties
| Compound Name | (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone |
| PubChem CID | 130572977 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone |
| SMILES | Cn1ncnc1C(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C7H7N5O/c1-12-7(8-4-11-12)6(13)5-2-9-10-3-5/h2-4H,1H3,(H,9,10) |
| InChIKey | HJTAQGCRWUMZGJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone?
The IUPAC name of (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone (CID 130572977) is (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone.
What is the SMILES notation for (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone?
The canonical SMILES for (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone is Cn1ncnc1C(=O)c1cn[nH]c1.
What is the InChIKey of (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone?
The InChIKey is HJTAQGCRWUMZGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O/c1-12-7(8-4-11-12)6(13)5-2-9-10-3-5/h2-4H,1H3,(H,9,10).
What are the key properties of (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone?
(2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone has a molecular weight of 177.17 g/mol, XLogP of -0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanone is sourced from PubChem (CID 130572977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).