C8H8IN3OS — CID 130575910
1-[5-(3-iodothiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylmethanamine (PubChem CID 130575910) has the molecular formula C8H8IN3OS and a molecular weight of 321.14 g/mol. Its IUPAC name is 1-[5-(3-iodothiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(3-iodothiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 130575910 |
| Molecular Formula | C8H8IN3OS |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 1-[5-(3-iodothiophen-2-yl)-1,2,4-oxadiazol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1noc(-c2sccc2I)n1 |
| InChI | InChI=1S/C8H8IN3OS/c1-10-4-6-11-8(13-12-6)7-5(9)2-3-14-7/h2-3,10H,4H2,1H3 |
| InChIKey | WJDHWRDSRBAALB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|