About 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine
3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine (PubChem CID 130577498) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine |
| PubChem CID | 130577498 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine |
| SMILES | CC1(Nc2cccc(Br)c2N)CCC1 |
| InChI | InChI=1S/C11H15BrN2/c1-11(6-3-7-11)14-9-5-2-4-8(12)10(9)13/h2,4-5,14H,3,6-7,13H2,1H3 |
| InChIKey | CPROZKDLQRUGPZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine?
The IUPAC name of 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine (CID 130577498) is 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine.
What is the SMILES notation for 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine?
The canonical SMILES for 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine is CC1(Nc2cccc(Br)c2N)CCC1.
What is the InChIKey of 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine?
The InChIKey is CPROZKDLQRUGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2/c1-11(6-3-7-11)14-9-5-2-4-8(12)10(9)13/h2,4-5,14H,3,6-7,13H2,1H3.
What are the key properties of 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine?
3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine has a molecular weight of 255.16 g/mol, XLogP of 3.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-N-(1-methylcyclobutyl)benzene-1,2-diamine is sourced from PubChem (CID 130577498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).