About 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone
2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 130579316) has the molecular formula C11H16O2S2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone |
| PubChem CID | 130579316 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)C1=COCC1 |
| InChI | InChI=1S/C11H16O2S2/c1-2-9-11(15-6-5-14-9)10(12)8-3-4-13-7-8/h7,9,11H,2-6H2,1H3 |
| InChIKey | MFXDJWDMNWLUHA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone?
The IUPAC name of 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone (CID 130579316) is 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone.
What is the SMILES notation for 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone?
The canonical SMILES for 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone is CCC1SCCSC1C(=O)C1=COCC1.
What is the InChIKey of 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone?
The InChIKey is MFXDJWDMNWLUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S2/c1-2-9-11(15-6-5-14-9)10(12)8-3-4-13-7-8/h7,9,11H,2-6H2,1H3.
What are the key properties of 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone?
2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone has a molecular weight of 244.38 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuran-4-yl-(3-ethyl-1,4-dithian-2-yl)methanone is sourced from PubChem (CID 130579316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).