C10H15NO2 — CID 130579695
(3-aminocyclopentyl)-(2,3-dihydrofuran-4-yl)methanone (PubChem CID 130579695) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(2,3-dihydrofuran-4-yl)methanone.
| Compound Name | (3-aminocyclopentyl)-(2,3-dihydrofuran-4-yl)methanone |
|---|---|
| PubChem CID | 130579695 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3-aminocyclopentyl)-(2,3-dihydrofuran-4-yl)methanone |
| SMILES | NC1CCC(C(=O)C2=COCC2)C1 |
| InChI | InChI=1S/C10H15NO2/c11-9-2-1-7(5-9)10(12)8-3-4-13-6-8/h6-7,9H,1-5,11H2 |
| InChIKey | XKVZISZMXPALAS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |