About 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone
2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone (PubChem CID 130579748) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone |
| PubChem CID | 130579748 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone |
| SMILES | CC1(C)CCCC1C(=O)C1=COCC1 |
| InChI | InChI=1S/C12H18O2/c1-12(2)6-3-4-10(12)11(13)9-5-7-14-8-9/h8,10H,3-7H2,1-2H3 |
| InChIKey | MRLQQQXNYQQWAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone?
The IUPAC name of 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone (CID 130579748) is 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone.
What is the SMILES notation for 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone?
The canonical SMILES for 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone is CC1(C)CCCC1C(=O)C1=COCC1.
What is the InChIKey of 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone?
The InChIKey is MRLQQQXNYQQWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-12(2)6-3-4-10(12)11(13)9-5-7-14-8-9/h8,10H,3-7H2,1-2H3.
What are the key properties of 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone?
2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone has a molecular weight of 194.27 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuran-4-yl-(2,2-dimethylcyclopentyl)methanone is sourced from PubChem (CID 130579748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).