C8H9N3O2S — CID 130580255
(2-methoxy-4-pyrazol-1-yl-1,3-thiazol-5-yl)methanol (PubChem CID 130580255) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is (2-methoxy-4-pyrazol-1-yl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-methoxy-4-pyrazol-1-yl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130580255 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (2-methoxy-4-pyrazol-1-yl-1,3-thiazol-5-yl)methanol |
| SMILES | COc1nc(-n2cccn2)c(CO)s1 |
| InChI | InChI=1S/C8H9N3O2S/c1-13-8-10-7(6(5-12)14-8)11-4-2-3-9-11/h2-4,12H,5H2,1H3 |
| InChIKey | VEDWBHSOWUOCIV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |