About 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile
4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile (PubChem CID 130580627) has the molecular formula C6H5ClN2OS
and a molecular weight of 188.64 g/mol. Its IUPAC name is 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile |
| PubChem CID | 130580627 |
| Molecular Formula | C6H5ClN2OS |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile |
| SMILES | CCOc1nc(Cl)c(C#N)s1 |
| InChI | InChI=1S/C6H5ClN2OS/c1-2-10-6-9-5(7)4(3-8)11-6/h2H2,1H3 |
| InChIKey | CRJDTXGUAXAQCI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile?
The IUPAC name of 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile (CID 130580627) is 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile.
What is the SMILES notation for 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile?
The canonical SMILES for 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile is CCOc1nc(Cl)c(C#N)s1.
What is the InChIKey of 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile?
The InChIKey is CRJDTXGUAXAQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2OS/c1-2-10-6-9-5(7)4(3-8)11-6/h2H2,1H3.
What are the key properties of 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile?
4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile has a molecular weight of 188.64 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethoxy-1,3-thiazole-5-carbonitrile is sourced from PubChem (CID 130580627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).