C3BrF7O — CID 13058064
1-bromo-1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethane (PubChem CID 13058064) has the molecular formula C3BrF7O and a molecular weight of 264.92 g/mol. Its IUPAC name is 1-bromo-1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethane.
| Compound Name | 1-bromo-1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethane |
|---|---|
| PubChem CID | 13058064 |
| Molecular Formula | C3BrF7O |
| Molecular Weight | 264.92 g/mol |
| Exact Mass | 263.90 |
| IUPAC Name | 1-bromo-1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethane |
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C3BrF7O/c4-1(5,6)2(7,8)12-3(9,10)11 |
| InChIKey | SGIPVGMKPYJVLG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|