About 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid
4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 130580867) has the molecular formula C7H6ClNO3S2
and a molecular weight of 251.72 g/mol. Its IUPAC name is 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 130580867 |
| Molecular Formula | C7H6ClNO3S2 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(SC2COC2)nc1Cl |
| InChI | InChI=1S/C7H6ClNO3S2/c8-5-4(6(10)11)14-7(9-5)13-3-1-12-2-3/h3H,1-2H2,(H,10,11) |
| InChIKey | DFKCFJRKXAJSLU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid (CID 130580867) is 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1sc(SC2COC2)nc1Cl.
What is the InChIKey of 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is DFKCFJRKXAJSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO3S2/c8-5-4(6(10)11)14-7(9-5)13-3-1-12-2-3/h3H,1-2H2,(H,10,11).
What are the key properties of 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid?
4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 251.72 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(oxetan-3-ylsulfanyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 130580867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).