About N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide
N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide (PubChem CID 130582043) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide.
Molecular Properties
| Compound Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide |
| PubChem CID | 130582043 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide |
| SMILES | CS(C)(=O)=NC(=O)CC1CCNC1 |
| InChI | InChI=1S/C8H16N2O2S/c1-13(2,12)10-8(11)5-7-3-4-9-6-7/h7,9H,3-6H2,1-2H3 |
| InChIKey | HMQFKKSSXJRNEA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide?
The IUPAC name of N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide (CID 130582043) is N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide.
What is the SMILES notation for N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide?
The canonical SMILES for N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide is CS(C)(=O)=NC(=O)CC1CCNC1.
What is the InChIKey of N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide?
The InChIKey is HMQFKKSSXJRNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-13(2,12)10-8(11)5-7-3-4-9-6-7/h7,9H,3-6H2,1-2H3.
What are the key properties of N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide?
N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide has a molecular weight of 204.29 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethyl(oxo)-λ6-sulfanylidene]-2-pyrrolidin-3-ylacetamide is sourced from PubChem (CID 130582043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).