About 4-methyl-5-methylidene-1,3-dioxolane
4-methyl-5-methylidene-1,3-dioxolane (PubChem CID 13058513) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is 4-methyl-5-methylidene-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-methyl-5-methylidene-1,3-dioxolane |
| PubChem CID | 13058513 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 4-methyl-5-methylidene-1,3-dioxolane |
| SMILES | C=C1OCOC1C |
| InChI | InChI=1S/C5H8O2/c1-4-5(2)7-3-6-4/h5H,1,3H2,2H3 |
| InChIKey | FZXKOBRIJUDCEB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5-methylidene-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylidene-1,3-dioxolane?
The IUPAC name of 4-methyl-5-methylidene-1,3-dioxolane (CID 13058513) is 4-methyl-5-methylidene-1,3-dioxolane.
What is the SMILES notation for 4-methyl-5-methylidene-1,3-dioxolane?
The canonical SMILES for 4-methyl-5-methylidene-1,3-dioxolane is C=C1OCOC1C.
What is the InChIKey of 4-methyl-5-methylidene-1,3-dioxolane?
The InChIKey is FZXKOBRIJUDCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2/c1-4-5(2)7-3-6-4/h5H,1,3H2,2H3.
What are the key properties of 4-methyl-5-methylidene-1,3-dioxolane?
4-methyl-5-methylidene-1,3-dioxolane has a molecular weight of 100.12 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylidene-1,3-dioxolane is sourced from PubChem (CID 13058513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).