C10H11ClO3S — CID 130585178
5-(5-chlorothiophen-2-yl)-5-methyloxolane-2-carboxylic acid (PubChem CID 130585178) has the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-5-methyloxolane-2-carboxylic acid.
| Compound Name | 5-(5-chlorothiophen-2-yl)-5-methyloxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 130585178 |
| Molecular Formula | C10H11ClO3S |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-5-methyloxolane-2-carboxylic acid |
| SMILES | CC1(c2ccc(Cl)s2)CCC(C(=O)O)O1 |
| InChI | InChI=1S/C10H11ClO3S/c1-10(7-2-3-8(11)15-7)5-4-6(14-10)9(12)13/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | URPKDXARAYNADT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |