About 2-(6,6-dimethyloxan-2-yl)acetonitrile
2-(6,6-dimethyloxan-2-yl)acetonitrile (PubChem CID 130585691) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-(6,6-dimethyloxan-2-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6,6-dimethyloxan-2-yl)acetonitrile |
| PubChem CID | 130585691 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-(6,6-dimethyloxan-2-yl)acetonitrile |
| SMILES | CC1(C)CCCC(CC#N)O1 |
| InChI | InChI=1S/C9H15NO/c1-9(2)6-3-4-8(11-9)5-7-10/h8H,3-6H2,1-2H3 |
| InChIKey | YPHSMBIUUFRMBU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6,6-dimethyloxan-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethyloxan-2-yl)acetonitrile?
The IUPAC name of 2-(6,6-dimethyloxan-2-yl)acetonitrile (CID 130585691) is 2-(6,6-dimethyloxan-2-yl)acetonitrile.
What is the SMILES notation for 2-(6,6-dimethyloxan-2-yl)acetonitrile?
The canonical SMILES for 2-(6,6-dimethyloxan-2-yl)acetonitrile is CC1(C)CCCC(CC#N)O1.
What is the InChIKey of 2-(6,6-dimethyloxan-2-yl)acetonitrile?
The InChIKey is YPHSMBIUUFRMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-9(2)6-3-4-8(11-9)5-7-10/h8H,3-6H2,1-2H3.
What are the key properties of 2-(6,6-dimethyloxan-2-yl)acetonitrile?
2-(6,6-dimethyloxan-2-yl)acetonitrile has a molecular weight of 153.22 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethyloxan-2-yl)acetonitrile is sourced from PubChem (CID 130585691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).