C8H12N4O — CID 130585938
1-(3-aminoazetidin-1-yl)-2-imidazol-1-ylethanone (PubChem CID 130585938) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(3-aminoazetidin-1-yl)-2-imidazol-1-ylethanone.
| Compound Name | 1-(3-aminoazetidin-1-yl)-2-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 130585938 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-(3-aminoazetidin-1-yl)-2-imidazol-1-ylethanone |
| SMILES | NC1CN(C(=O)Cn2ccnc2)C1 |
| InChI | InChI=1S/C8H12N4O/c9-7-3-12(4-7)8(13)5-11-2-1-10-6-11/h1-2,6-7H,3-5,9H2 |
| InChIKey | BRRCKFHREDVSAA-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |