About N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine
N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine (PubChem CID 130586021) has the molecular formula C7H8N4OS
and a molecular weight of 196.24 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine |
| PubChem CID | 130586021 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine |
| SMILES | Cc1cc(CNc2cnns2)on1 |
| InChI | InChI=1S/C7H8N4OS/c1-5-2-6(12-10-5)3-8-7-4-9-11-13-7/h2,4,8H,3H2,1H3 |
| InChIKey | MIZKGVSJENCFAB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine?
The IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine (CID 130586021) is N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine.
What is the SMILES notation for N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine?
The canonical SMILES for N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine is Cc1cc(CNc2cnns2)on1.
What is the InChIKey of N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine?
The InChIKey is MIZKGVSJENCFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-5-2-6(12-10-5)3-8-7-4-9-11-13-7/h2,4,8H,3H2,1H3.
What are the key properties of N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine?
N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine has a molecular weight of 196.24 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2-oxazol-5-yl)methyl]thiadiazol-5-amine is sourced from PubChem (CID 130586021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).