C7H6N2O — CID 130586140
(E)-3-(3-methyl-1,2-oxazol-5-yl)prop-2-enenitrile (PubChem CID 130586140) has the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. Its IUPAC name is (E)-3-(3-methyl-1,2-oxazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-methyl-1,2-oxazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 130586140 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | (E)-3-(3-methyl-1,2-oxazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)on1 |
| InChI | InChI=1S/C7H6N2O/c1-6-5-7(10-9-6)3-2-4-8/h2-3,5H,1H3/b3-2+ |
| InChIKey | JMAUOZMPMNSELN-NSCUHMNNSA-N |
| XLogP | 1.52 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|