C10H14ClFN2 — CID 130589138
1-N-(3-chloro-5-fluorophenyl)-2-methylpropane-1,2-diamine (PubChem CID 130589138) has the molecular formula C10H14ClFN2 and a molecular weight of 216.69 g/mol. Its IUPAC name is 1-N-(3-chloro-5-fluorophenyl)-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-(3-chloro-5-fluorophenyl)-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 130589138 |
| Molecular Formula | C10H14ClFN2 |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-N-(3-chloro-5-fluorophenyl)-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C10H14ClFN2/c1-10(2,13)6-14-9-4-7(11)3-8(12)5-9/h3-5,14H,6,13H2,1-2H3 |
| InChIKey | ALXZPTPWXKJZKH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |